C25H35N2O11S3- — CID 157066304
N-tert-butyl-1-[2-methoxysulfonyl-4-(sulfomethyl)phenyl]methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-methylbenzenesulfonate (PubChem CID 157066304) has the molecular formula C25H35N2O11S3- and a molecular weight of 635.76 g/mol. Its IUPAC name is N-tert-butyl-1-[2-methoxysulfonyl-4-(sulfomethyl)phenyl]methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-methylbenzenesulfonate.
| Compound Name | N-tert-butyl-1-[2-methoxysulfonyl-4-(sulfomethyl)phenyl]methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 157066304 |
| Molecular Formula | C25H35N2O11S3- |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | N-tert-butyl-1-[2-methoxysulfonyl-4-(sulfomethyl)phenyl]methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1cc(CS(=O)(=O)O)ccc1C=[N+]([O-])C(C)(C)C.Cc1ccc(C=[N+]([O-])C(C)(C)C)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C13H19NO7S2.C12H17NO4S/c1-13(2,3)14(15)8-11-6-5-10(9-22(16,17)18)7-12(11)23(19,20)21-4;1-9-5-6-10(8-13(14)12(2,3)4)11(7-9)18(15,16)17/h5-8H,9H2,1-4H3,(H,16,17,18);5-8H,1-4H3,(H,15,16,17)/p-1 |
| InChIKey | YRMWKWDAFWTFKM-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 207.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|