C24H32N2O8S2-2 — CID 160988097
N-tert-butyl-1-(2,4-dimethylphenyl)methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-oxidoperoxysulfanylbenzenesulfonate (PubChem CID 160988097) has the molecular formula C24H32N2O8S2-2 and a molecular weight of 540.66 g/mol. Its IUPAC name is N-tert-butyl-1-(2,4-dimethylphenyl)methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-oxidoperoxysulfanylbenzenesulfonate.
| Compound Name | N-tert-butyl-1-(2,4-dimethylphenyl)methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-oxidoperoxysulfanylbenzenesulfonate |
|---|---|
| PubChem CID | 160988097 |
| Molecular Formula | C24H32N2O8S2-2 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-tert-butyl-1-(2,4-dimethylphenyl)methanimine oxide;2-[[tert-butyl(oxido)azaniumylidene]methyl]-5-oxidoperoxysulfanylbenzenesulfonate |
| SMILES | CC(C)(C)[N+]([O-])=Cc1ccc(SOO[O-])cc1S(=O)(=O)[O-].Cc1ccc(C=[N+]([O-])C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C13H19NO.C11H15NO7S2/c1-10-6-7-12(11(2)8-10)9-14(15)13(3,4)5;1-11(2,3)12(13)7-8-4-5-9(20-19-18-14)6-10(8)21(15,16)17/h6-9H,1-5H3;4-7,14H,1-3H3,(H,15,16,17)/p-2 |
| InChIKey | GVVUJZRRBHUDEX-UHFFFAOYSA-L |
| XLogP | 3.58 |
| TPSA | 150.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|