C8H9CsO3S — CID 100951961
cesium 2,5-dimethylbenzenesulfonate (PubChem CID 100951961) has the molecular formula C8H9CsO3S and a molecular weight of 318.13 g/mol. Its IUPAC name is cesium 2,5-dimethylbenzenesulfonate.
| Compound Name | cesium 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 100951961 |
| Molecular Formula | C8H9CsO3S |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | cesium 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)[O-])c1.[Cs+] |
| InChI | InChI=1S/C8H10O3S.Cs/c1-6-3-4-7(2)8(5-6)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | FJJXXQMWUMEIIQ-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|