cesium 2,5-dimethylbenzenesulfonate

C8H9CsO3S — CID 100951961

IUPACcesium 2,5-dimethylbenzenesulfonate
SMILESCc1ccc(C)c(S(=O)(=O)[O-])c1.[Cs+]
InChIInChI=1S/C8H10O3S.Cs/c1-6-3-4-7(2)8(5-6)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1
InChIKeyFJJXXQMWUMEIIQ-UHFFFAOYSA-M
MW318.13 g/mol
LogP-1.79
Rot. Bonds1

About cesium 2,5-dimethylbenzenesulfonate

cesium 2,5-dimethylbenzenesulfonate (PubChem CID 100951961) has the molecular formula C8H9CsO3S and a molecular weight of 318.13 g/mol. Its IUPAC name is cesium 2,5-dimethylbenzenesulfonate.

Molecular Properties

Compound Namecesium 2,5-dimethylbenzenesulfonate
PubChem CID100951961
Molecular FormulaC8H9CsO3S
Molecular Weight318.13 g/mol
Exact Mass317.93
IUPAC Namecesium 2,5-dimethylbenzenesulfonate
SMILESCc1ccc(C)c(S(=O)(=O)[O-])c1.[Cs+]
InChIInChI=1S/C8H10O3S.Cs/c1-6-3-4-7(2)8(5-6)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1
InChIKeyFJJXXQMWUMEIIQ-UHFFFAOYSA-M
XLogP-1.79
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.13
LogP ≤ 5-1.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze cesium 2,5-dimethylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cesium 2,5-dimethylbenzenesulfonate?
The IUPAC name of cesium 2,5-dimethylbenzenesulfonate (CID 100951961) is cesium 2,5-dimethylbenzenesulfonate.
What is the SMILES notation for cesium 2,5-dimethylbenzenesulfonate?
The canonical SMILES for cesium 2,5-dimethylbenzenesulfonate is Cc1ccc(C)c(S(=O)(=O)[O-])c1.[Cs+].
What is the InChIKey of cesium 2,5-dimethylbenzenesulfonate?
The InChIKey is FJJXXQMWUMEIIQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O3S.Cs/c1-6-3-4-7(2)8(5-6)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1.
What are the key properties of cesium 2,5-dimethylbenzenesulfonate?
cesium 2,5-dimethylbenzenesulfonate has a molecular weight of 318.13 g/mol, XLogP of -1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2,5-dimethylbenzenesulfonate is sourced from PubChem (CID 100951961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).