C9H10F2O2S — CID 4163708
2-(difluoromethylsulfonyl)-1,4-dimethylbenzene (PubChem CID 4163708) has the molecular formula C9H10F2O2S and a molecular weight of 220.24 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-1,4-dimethylbenzene.
| Compound Name | 2-(difluoromethylsulfonyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 4163708 |
| Molecular Formula | C9H10F2O2S |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C(F)F)c1 |
| InChI | InChI=1S/C9H10F2O2S/c1-6-3-4-7(2)8(5-6)14(12,13)9(10)11/h3-5,9H,1-2H3 |
| InChIKey | OXAFRBYZAGHGRQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |