C14H23NO2S — CID 64640442
1-(2,5-dimethylphenyl)sulfonyl-3,3-dimethylbutan-2-amine (PubChem CID 64640442) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 64640442 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-3,3-dimethylbutan-2-amine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)CC(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H23NO2S/c1-10-6-7-11(2)12(8-10)18(16,17)9-13(15)14(3,4)5/h6-8,13H,9,15H2,1-5H3 |
| InChIKey | ULIQAPBSPOWBMI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |