C11H17NO2S — CID 117036341
N-[(2,5-dimethylphenyl)sulfonylmethyl]ethanamine (PubChem CID 117036341) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)sulfonylmethyl]ethanamine.
| Compound Name | N-[(2,5-dimethylphenyl)sulfonylmethyl]ethanamine |
|---|---|
| PubChem CID | 117036341 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-[(2,5-dimethylphenyl)sulfonylmethyl]ethanamine |
| SMILES | CCNCS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C11H17NO2S/c1-4-12-8-15(13,14)11-7-9(2)5-6-10(11)3/h5-7,12H,4,8H2,1-3H3 |
| InChIKey | NRJJHJMMKPUCQP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |