C14H15NO2S — CID 91652487
4-[(2,5-dimethylphenyl)sulfonylmethyl]pyridine (PubChem CID 91652487) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfonylmethyl]pyridine.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfonylmethyl]pyridine |
|---|---|
| PubChem CID | 91652487 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfonylmethyl]pyridine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Cc2ccncc2)c1 |
| InChI | InChI=1S/C14H15NO2S/c1-11-3-4-12(2)14(9-11)18(16,17)10-13-5-7-15-8-6-13/h3-9H,10H2,1-2H3 |
| InChIKey | IFSSOXGFXQXKIL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |