C16H19NO2S — CID 20704883
3-benzylsulfonyl-N,N,4-trimethylaniline (PubChem CID 20704883) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-benzylsulfonyl-N,N,4-trimethylaniline.
| Compound Name | 3-benzylsulfonyl-N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 20704883 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-benzylsulfonyl-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)cc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO2S/c1-13-9-10-15(17(2)3)11-16(13)20(18,19)12-14-7-5-4-6-8-14/h4-11H,12H2,1-3H3 |
| InChIKey | RELYYRVDGUINJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |