C28H20O6S2 — CID 141242164
1,4-bis(benzylsulfonyl)anthracene-9,10-dione (PubChem CID 141242164) has the molecular formula C28H20O6S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is 1,4-bis(benzylsulfonyl)anthracene-9,10-dione.
| Compound Name | 1,4-bis(benzylsulfonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 141242164 |
| Molecular Formula | C28H20O6S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 1,4-bis(benzylsulfonyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(S(=O)(=O)Cc3ccccc3)ccc(S(=O)(=O)Cc3ccccc3)c21 |
| InChI | InChI=1S/C28H20O6S2/c29-27-21-13-7-8-14-22(21)28(30)26-24(36(33,34)18-20-11-5-2-6-12-20)16-15-23(25(26)27)35(31,32)17-19-9-3-1-4-10-19/h1-16H,17-18H2 |
| InChIKey | WUUCKRPTXFYYLI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|