C12H10F2N2O4S — CID 6421518
5-benzylsulfonyl-6-(difluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 6421518) has the molecular formula C12H10F2N2O4S and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-benzylsulfonyl-6-(difluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-benzylsulfonyl-6-(difluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6421518 |
| Molecular Formula | C12H10F2N2O4S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 5-benzylsulfonyl-6-(difluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C(F)F)c(S(=O)(=O)Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H10F2N2O4S/c13-10(14)8-9(11(17)16-12(18)15-8)21(19,20)6-7-4-2-1-3-5-7/h1-5,10H,6H2,(H2,15,16,17,18) |
| InChIKey | WQLMIJULBYKJLR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |