C20H25NO3S — CID 59962532
3-[2-benzyl-4-(dimethylamino)phenyl]sulfonyl-2,2-dimethylpropanal (PubChem CID 59962532) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 3-[2-benzyl-4-(dimethylamino)phenyl]sulfonyl-2,2-dimethylpropanal.
| Compound Name | 3-[2-benzyl-4-(dimethylamino)phenyl]sulfonyl-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 59962532 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-[2-benzyl-4-(dimethylamino)phenyl]sulfonyl-2,2-dimethylpropanal |
| SMILES | CN(C)c1ccc(S(=O)(=O)CC(C)(C)C=O)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H25NO3S/c1-20(2,14-22)15-25(23,24)19-11-10-18(21(3)4)13-17(19)12-16-8-6-5-7-9-16/h5-11,13-14H,12,15H2,1-4H3 |
| InChIKey | OORPURDXEHBVJH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|