C20H21BFNO5S — CID 143885274
CID 143885274 (PubChem CID 143885274) has the molecular formula C20H21BFNO5S and a molecular weight of 417.27 g/mol.
| Compound Name | CID 143885274 |
|---|---|
| PubChem CID | 143885274 |
| Molecular Formula | C20H21BFNO5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | — |
| SMILES | [B][C@@](C=O)(CCCC)CS(=O)(=O)c1ccc(F)cc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21BFNO5S/c1-2-3-9-20(21,13-24)14-29(27,28)19-8-7-17(22)12-16(19)10-15-5-4-6-18(11-15)23(25)26/h4-8,11-13H,2-3,9-10,14H2,1H3/t20-/m1/s1 |
| InChIKey | KLCUCJHXHYWNTE-HXUWFJFHSA-N |
| XLogP | 3.81 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|