C20H24FNO3S — CID 70952026
(2S)-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol (PubChem CID 70952026) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is (2S)-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol.
| Compound Name | (2S)-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 70952026 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2S)-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCCC(CO)CSc1ccc(F)cc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24FNO3S/c1-2-3-5-16(13-23)14-26-20-9-8-18(21)12-17(20)10-15-6-4-7-19(11-15)22(24)25/h4,6-9,11-12,16,23H,2-3,5,10,13-14H2,1H3 |
| InChIKey | GCHVJLQYOGTIEX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|