C22H28FNO2S — CID 88893746
(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrosophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol (PubChem CID 88893746) has the molecular formula C22H28FNO2S and a molecular weight of 389.54 g/mol. Its IUPAC name is (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrosophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol.
| Compound Name | (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrosophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 88893746 |
| Molecular Formula | C22H28FNO2S |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrosophenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCC[C@](CC)(CO)CSc1ccc(F)cc1Cc1cccc(N=O)c1 |
| InChI | InChI=1S/C22H28FNO2S/c1-3-5-11-22(4-2,15-25)16-27-21-10-9-19(23)14-18(21)12-17-7-6-8-20(13-17)24-26/h6-10,13-14,25H,3-5,11-12,15-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | OHLOQCKYELDVMG-JOCHJYFZSA-N |
| XLogP | 6.49 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |