C25H35FOS — CID 22325199
2-butyl-2-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]hexan-1-ol (PubChem CID 22325199) has the molecular formula C25H35FOS and a molecular weight of 402.62 g/mol. Its IUPAC name is 2-butyl-2-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]hexan-1-ol.
| Compound Name | 2-butyl-2-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 22325199 |
| Molecular Formula | C25H35FOS |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-butyl-2-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)CSc1ccc(C)cc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H35FOS/c1-4-6-14-25(18-27,15-7-5-2)19-28-24-13-8-20(3)16-22(24)17-21-9-11-23(26)12-10-21/h8-13,16,27H,4-7,14-15,17-19H2,1-3H3 |
| InChIKey | IRMDDDHGMUGNNE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |