C25H33FO3S — CID 59109048
3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfonylmethyl]-2-propylheptanal (PubChem CID 59109048) has the molecular formula C25H33FO3S and a molecular weight of 432.60 g/mol. Its IUPAC name is 3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfonylmethyl]-2-propylheptanal.
| Compound Name | 3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfonylmethyl]-2-propylheptanal |
|---|---|
| PubChem CID | 59109048 |
| Molecular Formula | C25H33FO3S |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfonylmethyl]-2-propylheptanal |
| SMILES | CCCCC(CS(=O)(=O)c1ccc(C)cc1Cc1ccc(F)cc1)C(C=O)CCC |
| InChI | InChI=1S/C25H33FO3S/c1-4-6-8-22(21(17-27)7-5-2)18-30(28,29)25-14-9-19(3)15-23(25)16-20-10-12-24(26)13-11-20/h9-15,17,21-22H,4-8,16,18H2,1-3H3 |
| InChIKey | MFMRPTYWJYYUCI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|