C44H54F2N2O10S2 — CID 159128934
(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexanal;(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexan-1-ol (PubChem CID 159128934) has the molecular formula C44H54F2N2O10S2 and a molecular weight of 873.05 g/mol. Its IUPAC name is (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexanal;(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexan-1-ol.
| Compound Name | (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexanal;(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 159128934 |
| Molecular Formula | C44H54F2N2O10S2 |
| Molecular Weight | 873.05 g/mol |
| Exact Mass | 872.32 |
| IUPAC Name | (2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexanal;(2R)-2-ethyl-2-[[4-fluoro-2-[(3-nitrophenyl)methyl]phenyl]sulfonylmethyl]hexan-1-ol |
| SMILES | CCCC[C@@](C=O)(CC)CS(=O)(=O)c1ccc(F)cc1Cc1cccc([N+](=O)[O-])c1.CCCC[C@](CC)(CO)CS(=O)(=O)c1ccc(F)cc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28FNO5S.C22H26FNO5S/c2*1-3-5-11-22(4-2,15-25)16-30(28,29)21-10-9-19(23)14-18(21)12-17-7-6-8-20(13-17)24(26)27/h6-10,13-14,25H,3-5,11-12,15-16H2,1-2H3;6-10,13-15H,3-5,11-12,16H2,1-2H3/t2*22-/m11/s1 |
| InChIKey | KGQBEYVBEQMMHT-AVHJOICASA-N |
| XLogP | 9.56 |
| TPSA | 191.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.05 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|