C26H39NO6S — CID 142219552
ethane;2-[[2-[(4-methoxyphenyl)methyl]-4-nitrophenyl]sulfonylmethyl]-2-methylhexanal (PubChem CID 142219552) has the molecular formula C26H39NO6S and a molecular weight of 493.67 g/mol. Its IUPAC name is ethane;2-[[2-[(4-methoxyphenyl)methyl]-4-nitrophenyl]sulfonylmethyl]-2-methylhexanal.
| Compound Name | ethane;2-[[2-[(4-methoxyphenyl)methyl]-4-nitrophenyl]sulfonylmethyl]-2-methylhexanal |
|---|---|
| PubChem CID | 142219552 |
| Molecular Formula | C26H39NO6S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | ethane;2-[[2-[(4-methoxyphenyl)methyl]-4-nitrophenyl]sulfonylmethyl]-2-methylhexanal |
| SMILES | CC.CC.CCCCC(C)(C=O)CS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO6S.2C2H6/c1-4-5-12-22(2,15-24)16-30(27,28)21-11-8-19(23(25)26)14-18(21)13-17-6-9-20(29-3)10-7-17;2*1-2/h6-11,14-15H,4-5,12-13,16H2,1-3H3;2*1-2H3 |
| InChIKey | GXMSIRWGVHAQSD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|