C23H30O4S — CID 22325202
2-[(2-benzyl-5-methoxyphenyl)sulfonylmethyl]-2-ethylhexanal (PubChem CID 22325202) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[(2-benzyl-5-methoxyphenyl)sulfonylmethyl]-2-ethylhexanal.
| Compound Name | 2-[(2-benzyl-5-methoxyphenyl)sulfonylmethyl]-2-ethylhexanal |
|---|---|
| PubChem CID | 22325202 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[(2-benzyl-5-methoxyphenyl)sulfonylmethyl]-2-ethylhexanal |
| SMILES | CCCCC(C=O)(CC)CS(=O)(=O)c1cc(OC)ccc1Cc1ccccc1 |
| InChI | InChI=1S/C23H30O4S/c1-4-6-14-23(5-2,17-24)18-28(25,26)22-16-21(27-3)13-12-20(22)15-19-10-8-7-9-11-19/h7-13,16-17H,4-6,14-15,18H2,1-3H3 |
| InChIKey | ZOSLFFLXHFSDCG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|