About CID 175226407
CID 175226407 (PubChem CID 175226407) has the molecular formula C21H22NO3S-
and a molecular weight of 368.48 g/mol.
Molecular Properties
| Compound Name | CID 175226407 |
| PubChem CID | 175226407 |
| Molecular Formula | C21H22NO3S- |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | — |
| SMILES | COc1ccc(Cc2ccccc2)c(Cc2ccccc2)c1.NS(=O)[O-] |
| InChI | InChI=1S/C21H20O.H3NO2S/c1-22-21-13-12-19(14-17-8-4-2-5-9-17)20(16-21)15-18-10-6-3-7-11-18;1-4(2)3/h2-13,16H,14-15H2,1H3;1H2,(H,2,3)/p-1 |
| InChIKey | GWNVRFYYQPSCCV-UHFFFAOYSA-M |
| XLogP | 3.62 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 175226407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175226407?
The IUPAC name of CID 175226407 (CID 175226407) is not available.
What is the SMILES notation for CID 175226407?
The canonical SMILES for CID 175226407 is COc1ccc(Cc2ccccc2)c(Cc2ccccc2)c1.NS(=O)[O-].
What is the InChIKey of CID 175226407?
The InChIKey is GWNVRFYYQPSCCV-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H20O.H3NO2S/c1-22-21-13-12-19(14-17-8-4-2-5-9-17)20(16-21)15-18-10-6-3-7-11-18;1-4(2)3/h2-13,16H,14-15H2,1H3;1H2,(H,2,3)/p-1.
What are the key properties of CID 175226407?
CID 175226407 has a molecular weight of 368.48 g/mol, XLogP of 3.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175226407 is sourced from PubChem (CID 175226407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).