C16H28O2 — CID 142135610
anisole;butane;2,2-dimethylpropanal (PubChem CID 142135610) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is anisole;butane;2,2-dimethylpropanal.
| Compound Name | anisole;butane;2,2-dimethylpropanal |
|---|---|
| PubChem CID | 142135610 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | anisole;butane;2,2-dimethylpropanal |
| SMILES | CC(C)(C)C=O.CCCC.COc1ccccc1 |
| InChI | InChI=1S/C7H8O.C5H10O.C4H10/c1-8-7-5-3-2-4-6-7;1-5(2,3)4-6;1-3-4-2/h2-6H,1H3;4H,1-3H3;3-4H2,1-2H3 |
| InChIKey | RSIISWAWYNCAJN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|