C23H22O2 — CID 135005803
(2S)-2-(4-methoxyphenyl)-2-methyl-3,3-diphenylpropanal (PubChem CID 135005803) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-2-methyl-3,3-diphenylpropanal.
| Compound Name | (2S)-2-(4-methoxyphenyl)-2-methyl-3,3-diphenylpropanal |
|---|---|
| PubChem CID | 135005803 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-2-methyl-3,3-diphenylpropanal |
| SMILES | COc1ccc([C@@](C)(C=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22O2/c1-23(17-24,20-13-15-21(25-2)16-14-20)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17,22H,1-2H3/t23-/m1/s1 |
| InChIKey | RWVAQGLNHGOFBY-HSZRJFAPSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|