C24H22O — CID 100913808
(E,2R,3R)-2-methyl-2,3,5-triphenylpent-4-enal (PubChem CID 100913808) has the molecular formula C24H22O and a molecular weight of 326.44 g/mol. Its IUPAC name is (E,2R,3R)-2-methyl-2,3,5-triphenylpent-4-enal.
| Compound Name | (E,2R,3R)-2-methyl-2,3,5-triphenylpent-4-enal |
|---|---|
| PubChem CID | 100913808 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (E,2R,3R)-2-methyl-2,3,5-triphenylpent-4-enal |
| SMILES | C[C@](C=O)(c1ccccc1)[C@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22O/c1-24(19-25,22-15-9-4-10-16-22)23(21-13-7-3-8-14-21)18-17-20-11-5-2-6-12-20/h2-19,23H,1H3/b18-17+/t23-,24+/m1/s1 |
| InChIKey | YFSVASHJBWPRPQ-MVUKWZHESA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|