C23H22O — CID 10615189
(E,2S,3R)-2,3,5-triphenylpent-4-en-2-ol (PubChem CID 10615189) has the molecular formula C23H22O and a molecular weight of 314.43 g/mol. Its IUPAC name is (E,2S,3R)-2,3,5-triphenylpent-4-en-2-ol.
| Compound Name | (E,2S,3R)-2,3,5-triphenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 10615189 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (E,2S,3R)-2,3,5-triphenylpent-4-en-2-ol |
| SMILES | C[C@@](O)(c1ccccc1)[C@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22O/c1-23(24,21-15-9-4-10-16-21)22(20-13-7-3-8-14-20)18-17-19-11-5-2-6-12-19/h2-18,22,24H,1H3/b18-17+/t22-,23-/m1/s1 |
| InChIKey | WOBHUTYNDFIARM-GERLKTCDSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |