C12H16O2 — CID 102188552
(E,2R,3R)-2-phenylhex-4-ene-2,3-diol (PubChem CID 102188552) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (E,2R,3R)-2-phenylhex-4-ene-2,3-diol.
| Compound Name | (E,2R,3R)-2-phenylhex-4-ene-2,3-diol |
|---|---|
| PubChem CID | 102188552 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (E,2R,3R)-2-phenylhex-4-ene-2,3-diol |
| SMILES | C/C=C/[C@@H](O)[C@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-3-7-11(13)12(2,14)10-8-5-4-6-9-10/h3-9,11,13-14H,1-2H3/b7-3+/t11-,12-/m1/s1 |
| InChIKey | QGNZEXZMVWDQDU-BKZLJMBUSA-N |
| XLogP | 1.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|