C18H30N2O — CID 139135197
(2R,3S)-3-(tert-butylamino)-4-tert-butylimino-2-phenylbutan-2-ol (PubChem CID 139135197) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (2R,3S)-3-(tert-butylamino)-4-tert-butylimino-2-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-(tert-butylamino)-4-tert-butylimino-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 139135197 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (2R,3S)-3-(tert-butylamino)-4-tert-butylimino-2-phenylbutan-2-ol |
| SMILES | CC(C)(C)/N=C/[C@H](NC(C)(C)C)[C@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-16(2,3)19-13-15(20-17(4,5)6)18(7,21)14-11-9-8-10-12-14/h8-13,15,20-21H,1-7H3/b19-13+/t15-,18+/m0/s1 |
| InChIKey | YXQKSBVCVMHFSP-DMCUMKSNSA-N |
| XLogP | 3.52 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|