C23H32N2O — CID 12970498
2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol (PubChem CID 12970498) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol.
| Compound Name | 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 12970498 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol |
| SMILES | CC(C)(C)/N=C/C(NC(C)(C)C)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c1-21(2,3)24-17-20(25-22(4,5)6)23(26,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20,25-26H,1-6H3/b24-17+ |
| InChIKey | FYYOLXADNIJKEB-JJIBRWJFSA-N |
| XLogP | 4.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|