About 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol
2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol (PubChem CID 12970498) has the molecular formula C23H32N2O
and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol |
| PubChem CID | 12970498 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol |
| SMILES | CC(C)(C)/N=C/C(NC(C)(C)C)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c1-21(2,3)24-17-20(25-22(4,5)6)23(26,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20,25-26H,1-6H3/b24-17+ |
| InChIKey | FYYOLXADNIJKEB-JJIBRWJFSA-N |
| XLogP | 4.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol?
The IUPAC name of 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol (CID 12970498) is 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol.
What is the SMILES notation for 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol?
The canonical SMILES for 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol is CC(C)(C)/N=C/C(NC(C)(C)C)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol?
The InChIKey is FYYOLXADNIJKEB-JJIBRWJFSA-N. The full InChI is InChI=1S/C23H32N2O/c1-21(2,3)24-17-20(25-22(4,5)6)23(26,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20,25-26H,1-6H3/b24-17+.
What are the key properties of 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol?
2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol has a molecular weight of 352.52 g/mol, XLogP of 4.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-3-tert-butylimino-1,1-diphenylpropan-1-ol is sourced from PubChem (CID 12970498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).