C25H28N2O — CID 24781288
(2S)-2-(4-methylpiperazin-1-yl)-1,1,2-triphenylethanol (PubChem CID 24781288) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S)-2-(4-methylpiperazin-1-yl)-1,1,2-triphenylethanol.
| Compound Name | (2S)-2-(4-methylpiperazin-1-yl)-1,1,2-triphenylethanol |
|---|---|
| PubChem CID | 24781288 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (2S)-2-(4-methylpiperazin-1-yl)-1,1,2-triphenylethanol |
| SMILES | CN1CCN([C@@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N2O/c1-26-17-19-27(20-18-26)24(21-11-5-2-6-12-21)25(28,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,24,28H,17-20H2,1H3/t24-/m0/s1 |
| InChIKey | APNGEVKZVHHNKA-DEOSSOPVSA-N |
| XLogP | 3.91 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |