C20H32N2O — CID 92573539
(1S,2R)-1-cyclohexyl-2-(4-methylpiperazin-1-yl)-1-phenylpropan-1-ol (PubChem CID 92573539) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyl-2-(4-methylpiperazin-1-yl)-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-1-cyclohexyl-2-(4-methylpiperazin-1-yl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 92573539 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | (1S,2R)-1-cyclohexyl-2-(4-methylpiperazin-1-yl)-1-phenylpropan-1-ol |
| SMILES | C[C@@H](N1CCN(C)CC1)[C@@](O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H32N2O/c1-17(22-15-13-21(2)14-16-22)20(23,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3,5-6,9-10,17,19,23H,4,7-8,11-16H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | WEMKXTZKYQLYKL-YLJYHZDGSA-N |
| XLogP | 3.09 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |