C18H28N2 — CID 24842055
1-[cyclohexyl(phenyl)methyl]-4-methylpiperazine (PubChem CID 24842055) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-[cyclohexyl(phenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[cyclohexyl(phenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 24842055 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-[cyclohexyl(phenyl)methyl]-4-methylpiperazine |
| SMILES | CN1CCN(C(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2,4-5,8-9,17-18H,3,6-7,10-15H2,1H3 |
| InChIKey | WCGAYNHELPEDLX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |