C21H35N2+ — CID 24842365
4-[cyclohexyl(phenyl)methyl]-1,1-diethylpiperazin-1-ium (PubChem CID 24842365) has the molecular formula C21H35N2+ and a molecular weight of 315.52 g/mol. Its IUPAC name is 4-[cyclohexyl(phenyl)methyl]-1,1-diethylpiperazin-1-ium.
| Compound Name | 4-[cyclohexyl(phenyl)methyl]-1,1-diethylpiperazin-1-ium |
|---|---|
| PubChem CID | 24842365 |
| Molecular Formula | C21H35N2+ |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | 4-[cyclohexyl(phenyl)methyl]-1,1-diethylpiperazin-1-ium |
| SMILES | CC[N+]1(CC)CCN(C(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H35N2/c1-3-23(4-2)17-15-22(16-18-23)21(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5,7-8,11-12,20-21H,3-4,6,9-10,13-18H2,1-2H3/q+1 |
| InChIKey | IFXLDZLQUAWKIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|