C18H26N2O — CID 91532833
1-[[4-(nitrosomethyl)cyclohexyl]-phenylmethyl]pyrrolidine (PubChem CID 91532833) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[[4-(nitrosomethyl)cyclohexyl]-phenylmethyl]pyrrolidine.
| Compound Name | 1-[[4-(nitrosomethyl)cyclohexyl]-phenylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 91532833 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[[4-(nitrosomethyl)cyclohexyl]-phenylmethyl]pyrrolidine |
| SMILES | O=NCC1CCC(C(c2ccccc2)N2CCCC2)CC1 |
| InChI | InChI=1S/C18H26N2O/c21-19-14-15-8-10-17(11-9-15)18(20-12-4-5-13-20)16-6-2-1-3-7-16/h1-3,6-7,15,17-18H,4-5,8-14H2 |
| InChIKey | YSNDARLYAYQFOA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |