C20H30N2O — CID 125491837
(2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetamide (PubChem CID 125491837) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetamide.
| Compound Name | (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 125491837 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetamide |
| SMILES | CC(C)N1CC[C@H]([C@@](C(N)=O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C20H30N2O/c1-15(2)22-13-12-18(14-22)20(19(21)23,17-10-6-7-11-17)16-8-4-3-5-9-16/h3-5,8-9,15,17-18H,6-7,10-14H2,1-2H3,(H2,21,23)/t18-,20+/m0/s1 |
| InChIKey | MTJMHBZMNZKIRT-AZUAARDMSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |