C18H26N2 — CID 125491857
(2S)-3-methyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]butanenitrile (PubChem CID 125491857) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2S)-3-methyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]butanenitrile.
| Compound Name | (2S)-3-methyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]butanenitrile |
|---|---|
| PubChem CID | 125491857 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2S)-3-methyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]butanenitrile |
| SMILES | CC(C)N1CC[C@H]([C@](C#N)(c2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C18H26N2/c1-14(2)18(13-19,16-8-6-5-7-9-16)17-10-11-20(12-17)15(3)4/h5-9,14-15,17H,10-12H2,1-4H3/t17-,18-/m0/s1 |
| InChIKey | NWHXQMQXMRSRQW-ROUUACIJSA-N |
| XLogP | 3.83 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |