C21H28ClNO — CID 54604951
1,1-diphenyl-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol;hydrochloride (PubChem CID 54604951) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is 1,1-diphenyl-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol;hydrochloride.
| Compound Name | 1,1-diphenyl-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 54604951 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1,1-diphenyl-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol;hydrochloride |
| SMILES | CC(C)N1CCC(CC(O)(c2ccccc2)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-17(2)22-14-13-18(16-22)15-21(23,19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,17-18,23H,13-16H2,1-2H3;1H |
| InChIKey | GUTOTUVLPUMCNU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |