C20H28N2 — CID 125491902
(2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetonitrile (PubChem CID 125491902) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetonitrile.
| Compound Name | (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 125491902 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (2R)-2-cyclopentyl-2-phenyl-2-[(3R)-1-propan-2-ylpyrrolidin-3-yl]acetonitrile |
| SMILES | CC(C)N1CC[C@H]([C@@](C#N)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C20H28N2/c1-16(2)22-13-12-19(14-22)20(15-21,18-10-6-7-11-18)17-8-4-3-5-9-17/h3-5,8-9,16,18-19H,6-7,10-14H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | RCIZTLVHJYJGHB-PMACEKPBSA-N |
| XLogP | 4.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |