C26H31N3O — CID 66961853
2-(4-tert-butylphenyl)-1,1-dipyridin-3-yl-2-pyrrolidin-1-ylethanol (PubChem CID 66961853) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1,1-dipyridin-3-yl-2-pyrrolidin-1-ylethanol.
| Compound Name | 2-(4-tert-butylphenyl)-1,1-dipyridin-3-yl-2-pyrrolidin-1-ylethanol |
|---|---|
| PubChem CID | 66961853 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1,1-dipyridin-3-yl-2-pyrrolidin-1-ylethanol |
| SMILES | CC(C)(C)c1ccc(C(N2CCCC2)C(O)(c2cccnc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C26H31N3O/c1-25(2,3)21-12-10-20(11-13-21)24(29-16-4-5-17-29)26(30,22-8-6-14-27-18-22)23-9-7-15-28-19-23/h6-15,18-19,24,30H,4-5,16-17H2,1-3H3 |
| InChIKey | OJEYCGPACYZBMW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |