C24H25F2N3O2 — CID 66962343
2-(3,3-difluoropiperidin-1-yl)-2-(3-methoxyphenyl)-1,1-dipyridin-3-ylethanol (PubChem CID 66962343) has the molecular formula C24H25F2N3O2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(3,3-difluoropiperidin-1-yl)-2-(3-methoxyphenyl)-1,1-dipyridin-3-ylethanol.
| Compound Name | 2-(3,3-difluoropiperidin-1-yl)-2-(3-methoxyphenyl)-1,1-dipyridin-3-ylethanol |
|---|---|
| PubChem CID | 66962343 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-(3,3-difluoropiperidin-1-yl)-2-(3-methoxyphenyl)-1,1-dipyridin-3-ylethanol |
| SMILES | COc1cccc(C(N2CCCC(F)(F)C2)C(O)(c2cccnc2)c2cccnc2)c1 |
| InChI | InChI=1S/C24H25F2N3O2/c1-31-21-9-2-6-18(14-21)22(29-13-5-10-23(25,26)17-29)24(30,19-7-3-11-27-15-19)20-8-4-12-28-16-20/h2-4,6-9,11-12,14-16,22,30H,5,10,13,17H2,1H3 |
| InChIKey | MXYYPWHQCYLXKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |