C17H18OS — CID 571021
2-methylsulfanyl-1,1-diphenylbut-3-en-1-ol (PubChem CID 571021) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-methylsulfanyl-1,1-diphenylbut-3-en-1-ol.
| Compound Name | 2-methylsulfanyl-1,1-diphenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 571021 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-methylsulfanyl-1,1-diphenylbut-3-en-1-ol |
| SMILES | C=CC(SC)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18OS/c1-3-16(19-2)17(18,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h3-13,16,18H,1H2,2H3 |
| InChIKey | RBAPYEVFEPRPFD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|