C17H18O2 — CID 11514371
2-[(1S,2R)-1-hydroxy-2-methyl-1-phenylbut-3-enyl]phenol (PubChem CID 11514371) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[(1S,2R)-1-hydroxy-2-methyl-1-phenylbut-3-enyl]phenol.
| Compound Name | 2-[(1S,2R)-1-hydroxy-2-methyl-1-phenylbut-3-enyl]phenol |
|---|---|
| PubChem CID | 11514371 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(1S,2R)-1-hydroxy-2-methyl-1-phenylbut-3-enyl]phenol |
| SMILES | C=C[C@@H](C)[C@](O)(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C17H18O2/c1-3-13(2)17(19,14-9-5-4-6-10-14)15-11-7-8-12-16(15)18/h3-13,18-19H,1H2,2H3/t13-,17+/m1/s1 |
| InChIKey | FWQISFGKEYKGAW-DYVFJYSZSA-N |
| XLogP | 3.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|