C18H22O2 — CID 131848491
(1S,2R)-3-methyl-1-(2-methylphenyl)-1-phenylbutane-1,2-diol (PubChem CID 131848491) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2R)-3-methyl-1-(2-methylphenyl)-1-phenylbutane-1,2-diol.
| Compound Name | (1S,2R)-3-methyl-1-(2-methylphenyl)-1-phenylbutane-1,2-diol |
|---|---|
| PubChem CID | 131848491 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,2R)-3-methyl-1-(2-methylphenyl)-1-phenylbutane-1,2-diol |
| SMILES | Cc1ccccc1[C@@](O)(c1ccccc1)[C@H](O)C(C)C |
| InChI | InChI=1S/C18H22O2/c1-13(2)17(19)18(20,15-10-5-4-6-11-15)16-12-8-7-9-14(16)3/h4-13,17,19-20H,1-3H3/t17-,18+/m1/s1 |
| InChIKey | JSINZAMEPSGLEH-MSOLQXFVSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |