C20H27NO — CID 22084889
(2R)-2-amino-4-methyl-1,1-bis(2-methylphenyl)pentan-1-ol (PubChem CID 22084889) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-1,1-bis(2-methylphenyl)pentan-1-ol.
| Compound Name | (2R)-2-amino-4-methyl-1,1-bis(2-methylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 22084889 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2R)-2-amino-4-methyl-1,1-bis(2-methylphenyl)pentan-1-ol |
| SMILES | Cc1ccccc1C(O)(c1ccccc1C)[C@H](N)CC(C)C |
| InChI | InChI=1S/C20H27NO/c1-14(2)13-19(21)20(22,17-11-7-5-9-15(17)3)18-12-8-6-10-16(18)4/h5-12,14,19,22H,13,21H2,1-4H3/t19-/m1/s1 |
| InChIKey | PMHJHVUCCNOGLV-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |