C23H24O — CID 139051359
(1S,2S)-1-(2-methylphenyl)-1,2-diphenylbutan-1-ol (PubChem CID 139051359) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is (1S,2S)-1-(2-methylphenyl)-1,2-diphenylbutan-1-ol.
| Compound Name | (1S,2S)-1-(2-methylphenyl)-1,2-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 139051359 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (1S,2S)-1-(2-methylphenyl)-1,2-diphenylbutan-1-ol |
| SMILES | CC[C@@H](c1ccccc1)[C@](O)(c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C23H24O/c1-3-21(19-13-6-4-7-14-19)23(24,20-15-8-5-9-16-20)22-17-11-10-12-18(22)2/h4-17,21,24H,3H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | JTLYVALQISPRES-JTHBVZDNSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |