C27H32OSi — CID 15527869
1,1,2-triphenyl-4-(trimethylsilylmethyl)pent-4-en-1-ol (PubChem CID 15527869) has the molecular formula C27H32OSi and a molecular weight of 400.64 g/mol. Its IUPAC name is 1,1,2-triphenyl-4-(trimethylsilylmethyl)pent-4-en-1-ol.
| Compound Name | 1,1,2-triphenyl-4-(trimethylsilylmethyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 15527869 |
| Molecular Formula | C27H32OSi |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1,1,2-triphenyl-4-(trimethylsilylmethyl)pent-4-en-1-ol |
| SMILES | C=C(CC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C27H32OSi/c1-22(21-29(2,3)4)20-26(23-14-8-5-9-15-23)27(28,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26,28H,1,20-21H2,2-4H3 |
| InChIKey | RAFWKPAFUSDHMJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|