About (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol
(1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol (PubChem CID 139051380) has the molecular formula C22H21FO
and a molecular weight of 320.41 g/mol. Its IUPAC name is (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol |
| PubChem CID | 139051380 |
| Molecular Formula | C22H21FO |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol |
| SMILES | CC[C@H](c1ccccc1)[C@](O)(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FO/c1-2-21(17-9-5-3-6-10-17)22(24,18-11-7-4-8-12-18)19-13-15-20(23)16-14-19/h3-16,21,24H,2H2,1H3/t21-,22+/m1/s1 |
| InChIKey | PKWCGWGPYGPHOQ-YADHBBJMSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol?
The IUPAC name of (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol (CID 139051380) is (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol.
What is the SMILES notation for (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol?
The canonical SMILES for (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol is CC[C@H](c1ccccc1)[C@](O)(c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol?
The InChIKey is PKWCGWGPYGPHOQ-YADHBBJMSA-N. The full InChI is InChI=1S/C22H21FO/c1-2-21(17-9-5-3-6-10-17)22(24,18-11-7-4-8-12-18)19-13-15-20(23)16-14-19/h3-16,21,24H,2H2,1H3/t21-,22+/m1/s1.
What are the key properties of (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol?
(1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol has a molecular weight of 320.41 g/mol, XLogP of 5.26, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-(4-fluorophenyl)-1,2-diphenylbutan-1-ol is sourced from PubChem (CID 139051380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).