C35H42O3Si — CID 54001098
1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenyl-1-(4-phenylmethoxyphenyl)butan-1-ol (PubChem CID 54001098) has the molecular formula C35H42O3Si and a molecular weight of 538.80 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenyl-1-(4-phenylmethoxyphenyl)butan-1-ol.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenyl-1-(4-phenylmethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 54001098 |
| Molecular Formula | C35H42O3Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-phenyl-1-(4-phenylmethoxyphenyl)butan-1-ol |
| SMILES | CCC(c1ccccc1)C(O)(c1ccc(OCc2ccccc2)cc1)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H42O3Si/c1-7-33(28-16-12-9-13-17-28)35(36,30-20-24-32(25-21-30)38-39(5,6)34(2,3)4)29-18-22-31(23-19-29)37-26-27-14-10-8-11-15-27/h8-25,33,36H,7,26H2,1-6H3 |
| InChIKey | KLRAYFSKKAZGPU-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|