C35H42O5Si — CID 11387547
(1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]-1-(4-phenylmethoxyphenyl)propane-1,2-diol (PubChem CID 11387547) has the molecular formula C35H42O5Si and a molecular weight of 570.80 g/mol. Its IUPAC name is (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]-1-(4-phenylmethoxyphenyl)propane-1,2-diol.
| Compound Name | (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]-1-(4-phenylmethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 11387547 |
| Molecular Formula | C35H42O5Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]-1-(4-phenylmethoxyphenyl)propane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(OCc2ccccc2)ccc1C[C@H](O)[C@@H](O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H42O5Si/c1-35(2,3)41(4,5)40-33-23-31(39-25-27-14-10-7-11-15-27)21-18-29(33)22-32(36)34(37)28-16-19-30(20-17-28)38-24-26-12-8-6-9-13-26/h6-21,23,32,34,36-37H,22,24-25H2,1-5H3/t32-,34-/m0/s1 |
| InChIKey | SJTBHWTUVCRKTM-TWJUONSBSA-N |
| XLogP | 7.87 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|