C38H48O8Si — CID 102101367
(1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-phenylmethoxyphenyl]-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol (PubChem CID 102101367) has the molecular formula C38H48O8Si and a molecular weight of 660.88 g/mol. Its IUPAC name is (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-phenylmethoxyphenyl]-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol.
| Compound Name | (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-phenylmethoxyphenyl]-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 102101367 |
| Molecular Formula | C38H48O8Si |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | (1S,2S)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-phenylmethoxyphenyl]-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol |
| SMILES | COCOc1cc(OCc2ccccc2)c(C[C@H](O)[C@@H](O)c2ccc(OCc3ccccc3)c(OC)c2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C38H48O8Si/c1-38(2,3)47(6,7)46-35-22-30(45-26-41-4)21-34(44-25-28-16-12-9-13-17-28)31(35)23-32(39)37(40)29-18-19-33(36(20-29)42-5)43-24-27-14-10-8-11-15-27/h8-22,32,37,39-40H,23-26H2,1-7H3/t32-,37-/m0/s1 |
| InChIKey | YVCZOIXJTIKNDD-OCZFFWILSA-N |
| XLogP | 7.86 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|