C32H54O6Si2 — CID 163284430
(2R,3S,4S)-1,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-2,3-dimethylbutane-1,4-diol (PubChem CID 163284430) has the molecular formula C32H54O6Si2 and a molecular weight of 590.95 g/mol. Its IUPAC name is (2R,3S,4S)-1,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-2,3-dimethylbutane-1,4-diol.
| Compound Name | (2R,3S,4S)-1,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-2,3-dimethylbutane-1,4-diol |
|---|---|
| PubChem CID | 163284430 |
| Molecular Formula | C32H54O6Si2 |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (2R,3S,4S)-1,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-2,3-dimethylbutane-1,4-diol |
| SMILES | COc1cc(C(O)[C@H](C)[C@H](C)[C@H](O)c2ccc(O[Si](C)(C)C(C)(C)C)c(OC)c2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O6Si2/c1-21(29(33)23-15-17-25(27(19-23)35-9)37-39(11,12)31(3,4)5)22(2)30(34)24-16-18-26(28(20-24)36-10)38-40(13,14)32(6,7)8/h15-22,29-30,33-34H,1-14H3/t21-,22+,29-,30?/m0/s1 |
| InChIKey | HUDVIPZHIPEVQZ-CFZTZQJTSA-N |
| XLogP | 8.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|