C16H29NO2Si — CID 167731618
2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methylethanamine (PubChem CID 167731618) has the molecular formula C16H29NO2Si and a molecular weight of 295.50 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methylethanamine.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 167731618 |
| Molecular Formula | C16H29NO2Si |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methylethanamine |
| SMILES | CNCCc1ccc(O[Si](C)(C)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C16H29NO2Si/c1-16(2,3)20(6,7)19-14-9-8-13(10-11-17-4)12-15(14)18-5/h8-9,12,17H,10-11H2,1-7H3 |
| InChIKey | NPNRIARDQYZTDP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|